Chapter (1) The Electronic Structures of Atoms, Periodic Table and Chemical Bonds

Saya Minn Thant (B.Ed.
) MATRICULATION CHEMISTRY EXAM SPECIAL
Chapter (1)
THE ELECTRONIC STRUCTURES OF ATOMS,
PERIODIC TABLE AND CHEMICAL BONDS
Practice Questions
Section (B) Question No.6: 2 marks
Fundamental particles
1. What are charges and masses of proton, neutron and electron?
2. Give the maximum number of electrons in shell number 1, 2 and 4.
3. Give the maximum number of electrons in M shell and O shell.
4. In a neutral atom of an element, the number of a certain particle or
particles is equal to the atomic number. Name the particle or particles.
5. Select the isotopes from the following and give reason for your answer.
35 235 40 238 29
17𝐶𝑙 , 92𝑈, 20𝐶𝑎, 92𝑈, 12𝑀𝑔,
6. Write down the notation of isotopes for an element ‘X’. Express the
corresponding terms.
7. Determine the number of electrons, protons and neutrons for 35 17𝐶𝑙 and
write down the possible isotopes.
Electronic Structures
8. Write down the complete electronic structure and essential electronic
structure of 19K and 14Si.
Periodic Table
9. Classify the following elements as alkali metal, alkaline earth metal,
halogen and noble gas.
11Na, 17Cl, 10Ne, 12Mg
10. Arrange the following elements in order of their increasing
electronegativity.
Oxygen, Carbon, Fluorine, Nitrogen
11. How many electrons are lose from K and Ca in forming K+ and Ca2+
ions?
12. Select the one which has the largest radius.
4Be, 12Mg, 20Ca and N, B, F
Page-1
Saya Minn Thant (B.Ed.) MATRICULATION CHEMISTRY EXAM SPECIAL
13. Select and give reason. Which one has the larger radius from the
following pair.
Fe, Fe2+, Fe3+ and Cl, Cl-
14. Select and give reason which one has the highest ionization energy.
3Li, 11Na, 19K
15. Explain why Be has higher ionization energy than B.
16. From the following elements, select the one which has the highest
electron affinity.
11Na, 17Cl, 18Ar
17. Explain that the halogens have the highest electron affinities whereas
the alkali metals have very low electron affinities.
Chemical Bonds
18. What type of bond is formed between 12A and 17B? Write down the
most likely formula of the compound.
19. What elements are most likely to form covalent compounds? Give an
example with the electron dot-cross formula.
20. Draw the electron dot-cross structure of BeCl2 and BF3.
21. What type of chemical bond is formed between :NH3 and H+ ion?
Explain.
22. Give the differences between ionic compounds and covalent
compounds based on their solubility, melting point, volatility and
electrical conductivity.
23. What type of chemical bond is formed between :NH3 and H+ ion?
Explain.
Practice Questions
1. Write down the

(i) essential electronic structure
(ii) group number
(iii) period number
(iv) the valence for 18Ar and 15P.
Page-2
2. Write down the

(i) complete electronic structure
(ii) the positions in the periodic table
(iii) chief valence and
(iv) the type of the element of X(2.8.1) and Y(2.7).
3. An atom A has an atomic number of 12 whereas an atom B has an
atomic number of 17.
(i) Write down the electronic structures of A and B.
(ii) Give the group number and period number of A and B.
(iii) What type of bond can be formed between A and B.
(iv) Write down the chemical formula of the compound formed.
4. An element E contains 2 electrons in K shell, 8 electrons in L shell and
2 electrons in M shell. Answer the followings;
(i) the complete electronic structure,
(ii) the group number,
(iii) the chief valence and
(iv) the name of the element E.
5. The following information regarding elements I to IV is provided.
Element Atomic Mass Complete Electronic
Number Number Structure
I 4 9 1s2, 2s2
II 18 40 1s2, 2s2 2p6, 3s2 3p6
III 17 35 1s2, 2s2 2p6, 3s2 3p5
IV 12 24 1s2, 2s2 2p6, 3s2
(i) Which element is a noble gas?
(ii) Which element has the highest electron affinity?
(iii) Which element has 18 neutrons in each atom?
(iv) Which of the elements have a valence of 2?
6. You are given the following elements.
5A, 11X, 17Y
(i) Which two elements will combine to form a covalent
compound?
(ii) Draw the electron dot-cross formula of the compound formed.
Page-3
(iii) Which two elements will combine to form an ionic

compound?
(iv) Draw the electron dot-cross formula of the compound formed.
7. A compound is formed between A(2.3) and B(2.7) elements.
(i) What type of bonding exists between A and B?
(ii) Write down the electron dot-cross structure of that compound.
(iii) What type of bond is formed between the above compound
and :NH3?
(iv) Draw the electron dot-cross formula of the compound formed.
8. (i) Arrange the following elements in order of their increasing
atomic radius.
9F, 6C, 8O, 7N
(ii) Select the one which of the following groups has the largest
ionization energy.
A(2.8.1) B(2.8.5) C(2.8.7)
(iii) Write down the electron dot-cross structure of PF5.
(v) Give the positions in the periodic table of element 13Al.
Page-4
Chapter (2)
THE GASEOUS STATE AND GAS LAWS
Practice Questions
1. What are the measurable quantities of the gas?
2. Which law represent the following statement? Write down its
mathematical expression.
“When the volume of a gas is increased, its pressure decreases
under constant temperature.”
“When the temperature is kept constant, the total pressure of a gas
mixture is the sum of the partial pressures of different gases.”
3. State Gay-Lussac’s law of combining volume of gases both in words
and mathematical expression.
4. Which one diffuses faster in each of the following pairs under
comparable conditions? (C = 12, O = 16, N = 14, S = 32, H = 1)
(a) CO2 and NO2 (b) SO2 and H2S
5. The volume of the gas will become zero at -2730C. Which temperature
scale represents the above statement? Write down the relation of
Kelvin temperature and Celsius temperature scales.
6. Summarize the effect of pressure on gaseous system.
7. Total pressure of oxygen and acetylene gas storage tank is 7400
mmHg. The pressure of oxygen is 3400 mmHg. What is the pressure
of acetylene gas?
8. The pressure of hydrogen gas collected over water at 270C is 76.7
mmHg. The vapour pressure of water at 270C is 26.7 mmHg. What is
the pressure of dry hydrogen?
9. What is the relative density of CO2? (C = 12, O = 16)
10. What will be the volume of hydrogen chloride gas when 100 cm3 of
hydrogen and 50 cm3 of chlorine are mixed? (All gases are measured
at the same condition.)
11. How many molecules are there in 16 g of sulphur? (S = 32)
12. How many molecules are there in 11.2 dm3 of carbon dioxide at STP?
Page-5
13. 16 g of sulphur dioxide occupies 5.6 dm3 at STP. What is the relative
molecular mass of the gas?
14. What is the mass of nitrogen gas enclosed in 11.2 dm3 at STP?
(N = 14)
Practice Questions
𝑃1 𝑉1 𝑃2 𝑇2
1. Derive the equation = for the combination of Boyle’s law and
𝑇1 𝑉2
Charles’ law.
2. The volume of a certain mass of gas occupies 965 cm3 at 51 mmHg.
What is the volume under 768 mmHg at the same temperature?
3. A certain mass of gas occupies 250 cm3 measured at 320C. At what
temperature in 0C will the gas occupy 235 cm3 under the same
pressure?
4. At 270C and 750 mmHg, a gas occupies 380 cm3. What is the volume
of the gas at STP?
5. The pressure of a gas at 370C is 760 mmHg. What is the pressure of
the gas at 970C at constant temperature?
6. 0.2 g of a gas occupies a volume of 185 cm3 measured over water at
766 mmHg and 220C. Vapour pressure of water at 220C is 21 mmHg.
What is the volume of the dry gas at STP?
7. What will be the volume of ammonia gas when 100 cm3 of nitrogen
gas and 150 cm3 of hydrogen gas are mixed? (All gases are measured
at the same condition.)
8. Helium gas diffuses twice as fast as a gas X. Calculate the molar mass
and relative density of the gas X. (He = 4)
9. What is the relative rate of diffusion of hydrogen and oxygen?(O=16,
H=1)
10. If it takes 1 minute for 50 cm3 of oxygen to diffuse through a pinhole,
how long will it take for the same volume of hydrogen to diffuse
through the same hole? (O=16, H=1)
Page-6
11. A gas with the relative density of 22 is given. Find the relative
molecular mass of the gas and mass of one mole of the gas in grams.
What volume would be occupied by 12 g of the gas at STP?
12. What are the relative density of NO and CO? (N=14, O=16, C=12)
13. You are provided with 44.8 dm3 of hydrogen gas at STP. Find the
amount of (i) moles (ii) molecules (iii) gram (iv) amu. (H=1)
14. 7 g of nitrogen gas is given. Calculate the moles, volume in dm3 at STP,
density and relative density of gas. (N=14)
15. 10 g of calcium carbonate is treated with dilute hydrochloric acid. The
liberated gas measured at STP is 1.661 dm3. Find the percentage purity
of calcium carbonate. (C=12, O=16, H=1, Ca=40)
16. How many grams of zinc will have to be treated with dilute
hydrochloric acid to liberate 1.85 dm3 of hydrogen at 270C and 750
mmHg? (Zn=65)
17. One mole of a gas occupies 25 litres and its density is 1.82gL-1 at a
particular temperature and pressure. What is the molecular weight?
What is the density of the gas at STP?
Page-7
Chapter (3)
STOICHIOMETRY
Practice Questions
1. Calculate the molarity of solution prepared by dissolving 0.44 g of
NaOH in 100cm3 of the solution. (H=1, O=16, Na=23)
2. What volume of 1.0 M sulphuric acid is required to react with 5.0 g of
zinc? (Zn=65)
3. Calculate the percent by mass of the element in each of the following
compound. (K=39, O=16, N=14)
Potassium oxide (K2O), Nitrogen dioxide (NO2)
4. Oxidation of 2.01 g of mercury yields 2.17 g of oxide of mercury. What
is the empirical formula of this oxide? (Hg=201, O=16)
5. If 20 cm3 of 0.5 M sulphuric acid and 60 cm3 of 0.1 M sulphuric acid
are mixed what will be the molarity of the final solution?
Practice Questions
1. Calculate the molarity of a sodium carbonate solution prepared by
adding 50g of pure sodium carbonate and sufficient water to make 1.5
dm3 solution. 21 cm3 of this solution was needed to neutralize 24.5 cm3
of sulphuric acid. What is the concentration of sulphuric acid solution?
(C=12, O=16, S=32, H=1, Na=23)
2. 30 cm3 of a potassium carbonate solution required 27.6 cm3 of 0.6 M
hydrochloric acid solution to neutralize it. Calculate the molarity of
potassium carbonate and convert the concentration into gdm-3. (C=12,
O=16, K=39)
3. 25 cm3 of 0.1 M sodium carbonate solution required 20 cm3 of
sulphuric acid solution. Calculate the molar concentration of sulphuric
acid. What volume of water should be added to 20 cm3 of the sulphuric
acid so that the concentration becomes exactly 0.1 M.
Page-8
4. 0.24 g of magnesium was dissolved in 25 cm3 of 1.5 M hydrochloric

acid. How many cubic centimeter of 0.1 M potassium hydroxide
solution will be necessary to neutralize the excess acid? (Mg=24)
5. 100 cm3 of concentrated hydrochloric acid were diluted to 1 dm3 with
distilled water. 29 cm3 of this diluted acid were needed to neutralize 25
cm3 of 0.05 M sodium carbonate solution. What is the concentration in
g dm-3 of the original acid?
6. How many cubic centimeters of 1M hydrochloric acid must be diluted
with water to make 1.5 dm3 of 0.25 M solution? If 25 cm3 of sodium
hydroxide neutralizes 22 cm3 of this diluted solution, what is the
molarity of sodium hydroxide solution?
7. Vinegar contains the organic acid, acetic acid (ethanoic acid)
HC2H3O2. When 6 g of vinegar was titrated with 0.105 M sodium
hydroxide, 43 cm3 of this base had to be added to reach the equivalence
point. What is the percentage by mass of acetic acid in this sample of
vinegar? (C=12, H=1, O=16)
8. 5 g of mixture of sodium carbonate and sodium chloride were made up
to 500 cm3 of solution. 25 cm3 of this solution required 18 cm3 of 0.1
M sulphuric acid for neutralization. Calculate the percentage by mass
of sodium chloride in mixture.
9. 4 g of a mixture of sodium carbonate and sand is treated with an excess
of dilute hydrochloric acid and 0.22 g of carbon dioxide is produced.
What are the percentages of sodium carbonate and sand in the original
mixture? (Na=23, C=12, O=16)
10. 5 g of a mixture of anhydrous sodium sulphate and sodium decahydrate
on heating to constant mass produces 3.2 g of anhydrous salt. What
percentages of anhydrous and hydrated salt are presented in the
mixture.
11. How many grams of sulphur would be precipitated on mixing 5 dm3 of
sulphur dioxide with 12 dm3 of hydrogen sulphide if both gases were
originally at 250C and 756 mmHg pressure?(S=32)
12. To 25 cm3 of a solution of sodium hydroxide of unknown
concentration, 50 cm3 of a 0.5 M hydrochloric acid solution was added,
and the resulting solution was titrated with standard 0.25 M sodium
Page-9
hydroxide solution. 22.3 cm3 of 0.25 M sodium hydroxide was sodium

hydroxide was required for neutralization. Calculate the original
concentration of the sodium hydroxide solution in g dm-3. (Na=23,
O=16, H=1)
Chapter (4)
ELECTROLYSIS
Practice Questions
1. What are the factors affecting the electrolysis products?

2. Write down the cathode and anode reactions for the electrolysis of
molten sodium chloride solution using platinum electrodes.
3. What is the net result for the electrolysis of aqueous copper (II)
sulphate solution using copper electrodes?
4. What mass of copper will be deposited during electrolysis by one
Faraday?
5. Draw the diagrams of electron flow and current flow for the conduction
in metal wire.
6. Distinguish between conductor and insulator.
7. Write down the equation for ionization of potassium argentocyanide
KAg(CN)2 solution and the reaction at the cathode for silver plating.
Practice Questions
1. Who put forward the ionic theory about the year 1880?
2. Calculate the mass of silver in grams deposited by passing a steady
current of 0.1 A for one hour through an excess of AgNO3 solution.
(Ag=108, 1 F=96500 C)
3. A steady current of 0.5 A was switched on and allowed to flow for one
hour through a dilute sulphuric acid. Calculate the volume of hydrogen
Page-10
which would be liberated at STP during the electrolysis. (1F=96500 C,

H=1)
4. What mass of copper and silver will be liberated during electrolysis by
a charge of one Faraday? (1 F=96500 C, Cu=63, Ag=108)
5. What mass of aluminium and copper will be liberated during
electrolysis by 19300 C? (Al=27, Cu=63, 1F=96500 C)
6. On passing a steady current of 0.75 A for 26 minutes through a metal
(II) sulphate solution, 0.458 g of metal is deposited. Calculate the
relative atomic mass of that metal. (one Faraday=96500 C)
7. What will be the quantity of electricity required for the deposition of
1.8 g of silver on the cathode? (1F=96500 C, Ag=108)
8. Calculate the time required to discharge 0.523g of copper by passing a
current of 0.3 A through an excess of copper (II) sulphate solution.
(Cu=63.54, one Faraday=96500 C)
9. An electric current is passed in turn through solutions of silver nitrate
and copper (II) sulphate in series. If 4.5g of silver is deposited at the
cathode of the first cell, calculate the mass of copper deposited in the
second cell.
10. An electric current is passed in turn through solutions of silver nitrate
and copper (II) sulphate in series. If 0.7g of silver is deposited at the
cathode of the first cell, calculate the volume of hydrogen liberated at
350C and 760 mmHg in the second cell.
Page-11
Chapter (5)
OXIDATION AND REDUCTION
Practice Questions
1. What is the oxidation number for the underlined elements in each of
the following substances?
KClO3, S2O52-, FeCl3, Cr2O72-
2. Select the oxidizing agents and reducing agents from the following list.
(a) Carbon, potassium, permanganate, chlorine, hydrogen sulphide
(b) Sodium sulphite, copper (II) oxide, potassium dichromate,
sulphur dioxide
(c) O2, H2S, CO, Cl2
3. (i) Does the following reaction represent oxidation-reduction
Reaction?
(ii) State which one is oxidized and which one is reduced. Give
reason for your answer.
(iii) Identify the oxidizing agents and reducing agents. Give
reason.
(a) Fe3+ + Al → Fe + Al3+
(b) 3H2O2 + Cr2O72- + 8H+ → 2Cr3+ + 3O2 + 7H2O
4. Identify the oxidizing agent and reducing agent from the following
reactions.
(i) Fe2O3 + 3CO → 2Fe + 3CO2
(ii) 2KI + Cl2 → 2KCl + I2
(iii) H2O2 + 2HCl + 2KI → 2KCl + I2 + 2H2O
(iv) SO2 + H2O + NaClO → NaCl + H2SO4
Page-12
Practice Questions
Balance the following redox reactions using either oxidation number

method or ion-electron (half-reaction) method.
Simple equations.
1. Cu 2+ + I- → CuI + I2
2. Fe3+ + Al → Fe + Al3+
3. Fe2+ + Cl2 → Fe3+ + Cl_
4. S2- + Cl2 → S + Cl-
5. ZnO + Cu → Zn + CuO
6. ZnO + C → Zn + CO
More complex equations.

7. MnO2 + HCl → MnCl2 + H2O + Cl2
8. H2SO4 + C → CO2 + SO2 + H2O
9. H2SO3 + HNO3 → H2SO4 + H2O + NO
10. H2SO4 + HI → I2 + H2S + H2O
11. H2O + Cl2 → HCl + O2
12. SO2 + H2O + NaClO → NaCl + H2SO4
13. CuO + H2 → Cu + H2O
14. Fe2O3 + CO → Fe + CO2
Equations including peroxides.

15. H2O2 + H+ + I- → H2O + I2
16. KI + HCl + H2O2 → I2 + KCl + H2O
Most complex equations.

17. H2S + KMnO4 + H2SO4 → MnSO4 + K2SO4 + H2O + S
18. Cr2O72- + I- + H+ → Cr3+ + I2 + H2O
19. H2O2 + Cr2O72- + H+ → 2Cr3+ + O2 + H2O
20. K2Cr2O7 + HI + HClO4 → KClO4 + Cr(ClO4)3 + I2 + H2O
21. Cr2O72- + H+ + SO2 → Cr3+ + SO42- + H2O
Page-13
22. K2Cr2O7+H2SO4+FeSO4 → Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O
Equations needed to break apart.

23. Mg + O2 → MgO
24. Fe + Cl2 → FeCl3
25. Br2 + H2 → HBr
26. FeCl2 + Cl2 → FeCl3
Equations without O on the right side.

27. MnO4- + S2- → Mn2+ + S
More practice questions.
28. MnO4- + NO2 + H2O → MnO2 + NO3 + OH
29. MnO4- + Fe2+ + H+ → Mn2+ + Fe3+ + H2O
30. Cu + HNO3 → Cu(NO3)2 + H2O + NO
31. Cl2 + NaOH → NaCl + NaClO3 + H2O
32. H2SO4 + C → CO2 + SO2 + H2O
33. H+ + NO3- + Fe2+ → NO2 + Fe3+ + H2O
34. SO2 + Br2 + H2O → H2SO4 + HBr
35. BrO3- + I- + H+ → Br- + I2 + H2O
36. H2S + Cl2 → HCl + S
37. P4 + HNO3 → H3PO4 + NO2 + H2O
Page-14
Chapter (6)
RATE OF REACTION AND EQUILIBRIA
Practice Questions
1. Aluminium foil reacts moderately with aqueous NaOH only when
warmed but powdered aluminium of the same mass reacts rapidly in
the cold. Explain why.
2. Explain why aluminium reacts much more readily than aluminium
foil of the same mass.
3. Sulphuric acid is manufactured by making use of the equilibrium
reaction.
2SO2 (g) + O2 (g) ⇌ 2SO3 (g)
Explain why an excess of air is necessary for the manufacturing.
4. Explain why rise in temperature increases the rate of reaction.
5. Why is chemical equilibrium referred to dynamic equilibrium?
Practice Questions
1. Answer the following questions.

(i) What are the factors affecting the rate of reaction.
(ii) What are the factors affecting the chemical equilibrium.
(iii) Explain the term dynamic equilibrium.
2. What would be effect of increasing temperature on the following
equilibrium.
2𝐶𝑂 (𝑔) + 𝑂2 (𝑔) ⇌ 2𝐶𝑂2 (𝑔) + ℎ𝑒𝑎𝑡
3. Predict the effect of decreasing temperature on the following
equilibrium.
2𝐶 (𝑠) + 𝑂2 (𝑔) ⇌ 2𝐶𝑂 (𝑔) + ℎ𝑒𝑎𝑡
4. What will be effect of increasing and decreasing temperature on the
following equilibrium.
2𝐻2 𝑂 (𝑔) + ℎ𝑒𝑎𝑡 ⇌ 2𝐻2 (𝑔) + 𝑂2 (𝑔)
Page-15
5. Predict the effect of increasing temperature on the following

equilibrium system.
2𝑁𝑂𝐶𝑙 (𝑔) ⇌ 2𝑁𝑂 (𝑔) + 𝐶𝑙2 (𝑔) ∆𝐻𝜃 = +115𝑘𝐽
6. Using Le Chatelier’s principle, predict the effect of increasing pressure
on the following equilibrium.
𝑁2 𝑂4 (𝑔) ⇌ 2𝑁𝑂2 (𝑔)
7. Predict the effect of decreasing pressure on the following equilibrium.
𝑁2 (𝑔) + 𝑂2 (𝑔) ⇌ 2𝑁𝑂 (𝑔)
8. How would you change the temperature and pressure on the following
equilibrium so that you could get the highest quantity of SO3 on the
right hand side?
2𝑆𝑂2 (𝑔) + 𝑂2 (𝑔) ⇌ 2𝑆𝑂3 (𝑔) + ℎ𝑒𝑎𝑡
9. What would be the effect of adding more Fe3+ ions and decreasing
concentration of Fe3+(aq) ions on the following equilibrium?
𝐹𝑒 3+ (𝑎𝑞) + 𝑆𝐶𝑁 − (𝑎𝑞) ⇌ 𝐹𝑒𝑆𝐶𝑁 2+ (𝑎𝑞)
10. What change will not affect the following equilibrium?
2𝑁𝑂 (𝑔) + 𝐶𝑙2 (𝑔) ⇌ 2𝑁𝑂𝐶𝑙 (𝑔)
Page-16
Chapter (7)
ENERGY CHANGES IN CHEMICAL REACTIONS
Practice Questions
1. Calculate the heat of formation of methane, CH4 (g), if its heat of

combustion is -780 kJmol-1. The heat of formation of CO2 (g) and H2O
(l) are -388 kJmol-1 and -360 kJmol-1, respectively.
2. Calculate the heat of formation of ethane, C2H6 (g), if its heat of
(l) are -393.5 kJmol-1 and -286.0 kJmol-1, respectively.
3. Calculate the heat of combustion of propane gas C3H8 (g) if its heat of
formation is -1800 kJmol-1. The heat of formation of CO2 (g) and H2O
4. Calculate the heat of formation of butane gas C4H10 (g) if its heat of
5. Calculate the heat of combustion of benzene, C6H6 (l), if its heat of
formation is +49.0 kJmol-1. The heat of formation of CO2 (g) and H2O
(l) are -393.5 kJmol-1 and -285.5 kJmol-1, respectively.
6. Calculate the heat of formation of gasoline, C8H18 (g), if heat of
combustion of gasoline, carbon and hydrogen are -5434 kJmol-1, -
393 kJmol-1 and -286 kJmol-1 respectively.
7. Calculate the heat of combustion of methanol, CH3OH (l), if its heat of
formation is +91 kJmol-1. The heat of formation of CO2 (g) and H2O (l)
are -393 kJmol-1 and -286 kJmol-1, respectively.
8. Calculate the heat of formation of C2H5OH (l) if the heat of combustion
of ethanol, carbon (graphite) and hydrogen are -1500 kJmol-1, -485
kJmol-1 and -375 kJmol-1, respectively.
9. Calculate the heat of formation of ethanal, CH3CHO (l), if its heat of
combustion is -1150 kJmol-1. The heat of formation of CO2 (g) and
H2O (l) are -393 kJmol-1 and -286 kJmol-1, respectively.
Page-17
10.Calculate the heat of combustion of dimethyl ether, CH3-O-CH3 (g), if

its heat of formation is -276 kJmol-1. The heat of formation of CO2 (g)
and H2O (l) are -393 kJmol-1 and -286 kJmol-1, respectively.
11.Calculate the heat of formation of methanoic acid, HCOOH (l) if its
heat of combustion is -1100 kJmol-1 and heats of formation of CO2 (g)
12.Calculate the heat of formation of ethanoic acid, CH3COOH (l) if its
heat of combustion is -486 kJmol-1 and heats of formation of CO2 (g)
13.Calculate the heat of formation of oxalic acid, C2H2O4 (s) if its heat of
combustion is -27 kJmol-1 and heats of combustion of carbon (graphite)
and hydrogen are -393 kJmol-1 and -286 kJmol-1, respectively.
14.Calculate the heat of formation of sugar, C12H22O11 (s), if its heat of
combustion is -5040 kJmol-1. The heat of formation of CO2 (g) and
H2O (l) are -393 kJmol-1 and -286 kJmol-1, respectively.
15.Calculate the heat of formation of carbon disulphide, CS2 (l) if its heat
of combustion is -1106 kJmol-1. The heat of formation of CO2 (g) and
SO2 (g) are -394 kJmol-1 and -296 kJmol-1, respectively.
16.The heat evolved in the combustion of methane is -890kJmol-1. How
many grams of methane would be required and how many grams of
carbon dioxide would be formed when 445.15 kJ of heat is evolved?
Page-18
Chapter (13)
ACIDS, BASES AND THEIR NEUTRALIZATION
Practice Questions
1. Show that pH + pOH = 14.

2. Calculate the pH and pOH of the aqueous solutions containing 0.25
mole of HCl per dm3 and 0.025 mole of NaOH per dm3.
3. Calculate the pH and pOH values of the solutions containing 0.315g of
HNO3 and 1.4 g of KOH per dm3 respectively.
4. Calculate the hydrogen ion concentration of the solutions having pOH
value of 7.8 and pH value of 6.5.
5. What is the hydroxide ion concentration of the solutions having the pH
value of 4.5 and pOH value of 8.9.
6. Calculate the pH of a buffer solution containing 0.2 mole of methanoic
acid (Ka = 1.8 x10-5) and 0.1 mole of sodium methanoate per dm3.
7. Calculate the pOH of a buffer solution containing 0.04 mole of
ethanoic acid (pKa = 4.7) and 0.4 mole of sodium ethanoate per 500
cm3 of solution.
8. (i) Arrange the following acids in order of increasing acid strength.
Give reasons for your arrangement.
Acid pKa
HCN 9.3
Cl-CH2COOH 2.9
CH3COOH 4.7
HCOOH 3.8
(ii) Calculate the pKa of methanoic acid (Ka = 1.8 x 10-4), ehanoic acid
(Ka = 1.8 x 10-5) and hydrogen cyanide (Ka = 1.8x10-6)
9. Would the pH of a solution of sodium ethanoate be greater or less than
7? Give an explanation for this. (KW = [H+][OH-]= 1 x 10-14)
10. Some ammonium chloride was dissolved in water and the solution has
a pH of 5. Explain the result. (KW = [H+][OH-] = 10-14)
Page-19
11. The pH of a solution of sodium chloride would be equal to 7. Explain

the result clearly.
12. Explain how a mixture of ammonium hydroxide and ammonium
chloride resists the change of pH in addition of a small amount of
strong acid or strong base.
13. Mention appropriate buffer solution for moderately acidic solution.
14. (i) When hydrogen chloride gas is dissolved in water, an equilibrium
is represented by
HCl (g) + H2O (l) ⇌ H3O+ (aq) + Cl- (aq)
I II III IV
Using the Roman numerals shown below each formula, which of these
combinations represents two bases, (I and II), (I and (IV), (II and III)
or (II and IV)? In the base pair that you have chosen, which one is a
weaker base?
(ii) Would the pH of a solution of sodium ethanoate be greater or less
than 7? Give an explanation for this.
Page-20

Chapter (1) The Electronic Structures of Atoms, Periodic Table and Chemical Bonds

Încărcat de

Informații document

Descriere originală:

Titlu original

Drepturi de autor

Formate disponibile

Partajați acest document

Partajați sau inserați document

Opțiuni de partajare

Vi se pare util acest document?

Este necorespunzător acest conținut?

Drepturi de autor:

Formate disponibile

Chapter (1) The Electronic Structures of Atoms, Periodic Table and Chemical Bonds

Încărcat de

Drepturi de autor:

Formate disponibile

Saya Minn Thant (B.Ed.

) MATRICULATION CHEMISTRY EXAM SPECIAL

1. Write down the

2. Write down the

(iii) Which two elements will combine to form an ionic

4. 0.24 g of magnesium was dissolved in 25 cm3 of 1.5 M hydrochloric

hydroxide solution. 22.3 cm3 of 0.25 M sodium hydroxide was sodium

1. What are the factors affecting the electrolysis products?

which would be liberated at STP during the electrolysis. (1F=96500 C,

Balance the following redox reactions using either oxidation number

More complex equations.

Equations including peroxides.

Most complex equations.

22. K2Cr2O7+H2SO4+FeSO4 → Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O

Equations needed to break apart.

Equations without O on the right side.

1. Answer the following questions.

5. Predict the effect of increasing temperature on the following

1. Calculate the heat of formation of methane, CH4 (g), if its heat of

10.Calculate the heat of combustion of dimethyl ether, CH3-O-CH3 (g), if

1. Show that pH + pOH = 14.

11. The pH of a solution of sodium chloride would be equal to 7. Explain

S-ar putea să vă placă și